| Identification |
| Name: | Benzamide,3,4,5-trimethoxy-N-3-piperidinyl- |
| Synonyms: | Benzamide,3,4,5-trimethoxy-N-3-piperidyl- (8CI);3-(3,4,5-Trimethoxybenzamido)piperidine;KU 54;3,4,5-Trimethoxy-N-(piperidin-3-yl)benzamide;3,4,5-Tris(methyloxy)-N-piperidin-3-ylbenzamide;BRN 0493078;SMR000466385;AC1L1KPB; |
| CAS: | 30751-05-4 |
| Molecular Formula: | C15H22N2O4 |
| Molecular Weight: | 294.34618 |
| InChI: | InChI=1S/C15H22N2O4/c1-19-12-7-10(8-13(20-2)14(12)21-3)15(18)17-11-5-4-6-16-9-11/h7-8,11,16H,4-6,9H2,1-3H3,(H,17,18) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.18 g/cm3 |
| Water Solubility: | soluble in chloroform, only slightly soluble in water, ether and benzene |
| Solubility: | soluble in chloroform, only slightly soluble in water, ether and benzene |
| Appearance: | white powder |
| Safety Data |
| |
 |
