| Identification | |
| Name: | Tumor necrosis factors |
| Synonyms: | Lymphokinesand Cytokines, tumor necrosis factor; Lymphokines and Cytokines, tumor necrosisfactor-a; Cachectin; Cachectin proteins;Cachectins; Cachetin; TNF; TNF (tumor necrosis factors); TNF-a; TNFa; Tumor necrosis factor; Tumor necrosis factor TNF-a; Tumor necrosis factor a; Tumor necrosis factor-alpha;Tumor necrosis factor-a |
| CAS: | 308079-78-9 |
| Molecular Formula: | C5H9NO3S |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C5H9NO3S/c1-3(7)6-4(2-10)5(8)9/h4,10H,2H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 109.5 deg C |
| Flash Point: | 105.6°C |
| Boiling Point: | 269.1°Cat760mmHg |
| Density: | 1.009g/cm3 |
| Solubility: | 1 G IN 5 ML WATER, 4 ML ALC; PRACTICALLY INSOL IN CHLOROFORM & ETHER Soluble in water, alcohol, hot isopropyl alcohol, methyl acetate, and ethyl acetate |
| Flash Point: | 105.6°C |
| Color: | Crystals from water WHITE, CRYSTALLINE POWDER |
| Safety Data | |
 |
|
