| Identification | |
| Name: | 2-Acetylphenylboronic acid |
| Synonyms: | Boronicacid, (2-acetylphenyl)- (9CI);Boronicacid, B-(2-acetylphenyl)-; |
| CAS: | 308103-40-4 |
| Molecular Formula: | C8H9BO3 |
| Molecular Weight: | 163.97 |
| InChI: | InChI=1/C8H9BO3/c1-6(10)7-4-2-3-5-8(7)9(11)12/h2-5,11-12H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 165.4 ºC |
| Boiling Point: | 349.9 ºC at 760 mmHg |
| Density: | 1.19 g/cm3 |
| Refractive index: | 1.535 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
2-Acetylphenylboronic acid (CAS NO.308103-40-4) is also named as (2-Acetylphenyl)boronic acid ; Boronic acid, B-(2-acetylphenyl)- ; 1-[2-(Dihydroxyboranyl)phenyl]ethan-1-one . 2-Acetylphenylboronic acid (CAS NO.308103-40-4) is white to light yellow crystal powder. |
| Flash Point: | 165.4 ºC |
| Storage Temperature: | 0-6°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
