Identification |
Name: | b-D-Glucopyranosiduronic acid, 4-(acetylamino)phenyl,methyl ester, 2,3,4-triacetate |
Synonyms: | Glucopyranosiduronicacid, p-acetamidophenyl, methyl ester, 2,3,4-triacetate, b-D- (8CI) |
CAS: | 30824-21-6 |
Molecular Formula: | C21H25 N O11 |
Molecular Weight: | 467.4233 |
InChI: | InChI=1/C21H25NO11/c1-10(23)22-14-6-8-15(9-7-14)32-21-19(31-13(4)26)17(30-12(3)25)16(29-11(2)24)18(33-21)20(27)28-5/h6-9,16-19,21H,1-5H3,(H,22,23)/t16-,17-,18?,19-,21+/m0/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 310.909°C |
Boiling Point: | 590.477°C at 760 mmHg |
Density: | 1.345g/cm3 |
Refractive index: | 1.538 |
Flash Point: | 310.909°C |
Usage: | Intermediate in the preparation of Acetaminophen metabolites |
Safety Data |
|
|