Identification |
Name: | Pentanol |
Synonyms: | pentan-1-ol;Amyl alcohol, n-;n-amyl alcohol;n-Butyl Carbinol;n-Pentanol;pentan-1-ol; |
CAS: | 30899-19-5 |
EINECS: | 250-378-8 |
Molecular Formula: | C5H12O |
Molecular Weight: | 314.28946 |
InChI: | InChI=1S/C17H14O6/c1-19-9-2-3-10-12(4-9)20-7-17(18)11-5-14-15(22-8-21-14)6-13(11)23-16(10)17/h2-6,16,18H,7-8H2,1H3/t16-,17+/m0/s1 |
Molecular Structure: |
|
Properties |
Transport: | UN 1105 3/PG 3 |
Melting Point: | ?117ºC |
Flash Point: | 109.4ºC |
Boiling Point: | 131-132 ºC |
Density: | 0.809 g/mL |
Refractive index: | n20/D 1.407 |
Water Solubility: | miscible with alcohol and ether |
Solubility: | miscible with alcohol and ether |
Appearance: | colorless Liquid |
Packinggroup: | III |
Flash Point: | 109.4ºC |
Storage Temperature: | Flammables area |
Color: | <20(APHA) |
Safety Data |
Hazard Symbols |
Xn: Harmful
|
|
|