Identification |
Name: | Phenol,4-amino-2,5-dimethyl- |
Synonyms: | 2,5-Xylenol,4-amino- (6CI,7CI,8CI);(2,5-Dimethyl-4-hydroxyphenyl)amine;2,5-Dimethyl-4-aminophenol;2,5-Dimethyl-4-hydroxyaniline;4-Amino-2,5-dimethylphenol; |
CAS: | 3096-71-7 |
EINECS: | 221-449-0 |
Molecular Formula: | C8H11NO |
Molecular Weight: | 137.18 |
InChI: | InChI=1/C8H11NO/c1-5-4-8(10)6(2)3-7(5)9/h3-4,10H,9H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.118 g/cm3 |
Stability: | Stable. Incompatible with acids, chloroformates, acid anhydrides, acid chlorides, strong oxidizing agents. |
Refractive index: | 1.6 |
Appearance: | Solid |
Specification: |
4-Amino-2,5-dimethylphenol , its cas register number is 3096-71-7. It also can be called 4-Amino-2,5-xylenol ; and Phenol, 4-amino-2,5-dimethyl- .
|
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |