| Identification | |
| Name: | 2H-1-Benzopyran-2-one,7-ethoxy- |
| Synonyms: | Coumarin,7-ethoxy- (6CI,8CI); 7-Ethoxycoumarin; Ethylumbelliferone |
| CAS: | 31005-02-4 |
| EINECS: | 250-429-4 |
| Molecular Formula: | C11H10 O3 |
| Molecular Weight: | 190.1953 |
| InChI: | InChI=1S/C11H10O3/c1-2-13-9-5-3-8-4-6-11(12)14-10(8)7-9/h3-7H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 88-90 °C(lit.) |
| Flash Point: | 143.1°C |
| Boiling Point: | 345°Cat760mmHg |
| Density: | 1.206g/cm3 |
| Refractive index: | 1.561 |
| Appearance: | Beige crystalline powder |
| Specification: |
2H-1-Benzopyran-2-one,7-ethoxy- , with CAS number of 31005-02-4, can be called 7-Ethoxy-1-benzopyran-2-one ; 7-ethoxy-1-benzopyrane-2-one ; 7-ethoxycoumarin ; ethoxycoumarin, 7- ; 2h-1-benzopyran-2-one, 7-ethoxy- ; coumarin, 7-ethoxy-;ethylumbelliferone ; 7-ethoxycoumarin, 99.5% . 2H-1-Benzopyran-2-one,7-ethoxy- (CAS NO.31005-02-4) is a beige crystalline powder,can be used as a substrate for CYP2B6. |
| Flash Point: | 143.1°C |
| Usage: | A substrate for CYP2B6 |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
