| Identification |
| Name: | N-Ethanoyl-D-erythro-sphingosine |
| Synonyms: | TOC Ceramide;D-erythro-Sphingoshine, N-Acetyl-;N-acetyl-D-sphingosine |
| CAS: | 3102-57-6 |
| Molecular Formula: | C20H39 N O3 |
| Molecular Weight: | 341.53 |
| InChI: | InChI=1/C20H39NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(24)19(17-22)21-18(2)23/h15-16,19-20,22,24H,3-14,17H2,1-2H3,(H,21,23)/b16-15+/t19-,20+/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 93-96 °C
|
| Flash Point: | 275.8°C |
| Boiling Point: | 532.4°Cat760mmHg |
| Density: | 0.964g/cm3 |
| Refractive index: | 1.484 |
| Biological Activity: | A potent modulator of cell proliferation and differentiation. Activates protein phosphatase-1 (PP1) and -2A (PP2A), as well as ceramide-activated protein phosphatase (CAPP) in vitro . |
| Flash Point: | 275.8°C |
| Storage Temperature: | −20°C |
| Color: | white |
| Usage: | A biologically active, cell permeable, but nonphysiologic ceramide analog. It inhibits cell proliferation and induces monocytic differentiation of HL-60 cells and induces apoptosis. It stimulates protein phosphatase 2A and activates MAP Kinase2 |
| Safety Data |
| |
 |
