Identification |
Name: | 1H-Imidazole,2-[1-(2,6-dichlorophenoxy)ethyl]-4,5-dihydro- |
CAS: | 31036-80-3 |
Molecular Formula: | C11H12 Cl2 N2 O |
Molecular Weight: | 259.13 |
InChI: | InChI=1/C11H12Cl2N2O/c1-7(11-14-5-6-15-11)16-10-8(12)3-2-4-9(10)13/h2-4,7H,5-6H2,1H3,(H,14,15) |
Molecular Structure: |
|
Properties |
Melting Point: | 127 |
Flash Point: | 208.7°C |
Boiling Point: | 421.5°Cat760mmHg |
Density: | 1.39g/cm3 |
Refractive index: | 1.61 |
Solubility: | Insoluble |
Flash Point: | 208.7°C |
Storage Temperature: | Store in original container in a cool dark place. |
Usage: | A short-acting anti-hypertensive, but more commonly used to alleviate physical symptoms of heroin and opiate withdrawal. |
Safety Data |
|
|