| Identification |
| Name: | Benzeneacetic acid, a-methyl-4-(2-methylpropyl)-,sodium salt (1:1) |
| Synonyms: | Benzeneaceticacid, a-methyl-4-(2-methylpropyl)-,sodium salt (9CI); Hydratropic acid, p-isobutyl-, sodium salt (8CI);2-(4-Isobutylphenyl)propionic acid sodium salt; Ibuprofen sodium; Ibuprofensodium salt; Sodium 2-(4-isobutylphenyl)propionate; Sodium ibuprofen |
| CAS: | 31121-93-4 |
| EINECS: | 250-477-6 |
| Molecular Formula: | C13H18 O2 . Na |
| Molecular Weight: | 206.28082 |
| InChI: | InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 75-77 deg C |
| Density: | 1.029g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents |
| Water Solubility: | H2O: 100 mg/mL, may be clear to slightly hazy |
| Solubility: | H2O: 100 mg/mL, may be clear to slightly hazy |
| Appearance: | white powder |
| Color: | Colorless, crystalline stable solid |
| Safety Data |
| |
 |
