| Identification |
| Name: | L-Glutamic acid,4-methyl-, (4R)- |
| Synonyms: | Glutamicacid, 4-methyl-, L-erythro- (8CI); L-Glutamic acid, 4-methyl-, erythro-;(2S,4R)-4-Methylglutamic acid; L-erythro-g-Methylglutamate; L-erythro-g-Methylglutamic acid; SYM 2081;erythro-L-4-Methylglutamic acid; erythro-g-Methyl-L-glutamic acid; erythro-g-Methylglutamic acid |
| CAS: | 31137-74-3 |
| Molecular Formula: | C6H11 N O4 |
| Molecular Weight: | 161.16 |
| InChI: | InChI=1/C6H11NO4/c1-3(5(8)9)2-4(7)6(10)11/h3-4H,2,7H2,1H3,(H,8,9)(H,10,11)/p-1/t3-,4+/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 153°C |
| Boiling Point: | 329.4°Cat760mmHg |
| Density: | g/cm3 |
| Biological Activity: | Potent and highly selective kainate receptor agonist, with an IC 50 for inhibition of [ 3 H]-kainate binding of 35 nM and almost 3,000- and 200-fold selectivity for kainate receptors over AMPA and NMDA receptors respectively. Also selectively inhibits the cloned excitatory amino acid transporter EAAT2 at higher concentrations. Also available as part of the Excitatory Amino Acid Transporter Inhibitor Tocriset™ and Kainate Receptor Tocriset™ . |
| Flash Point: | 153°C |
| Color: | white |
| Usage: | A highly selective and potent agonist for kainate receptors. |
| Safety Data |
| |
 |
