| Identification | |
| Name: | 1-benzyl-2,4,5-tribromo-imidazole |
| Synonyms: | 1-BENZYL-2,4,5-TRIBROMO-1H-IMIDAZOLE |
| CAS: | 31250-80-3 |
| Molecular Formula: | C10H7Br3N2 |
| Molecular Weight: | 394.89 |
| InChI: | InChI=1/C10H7Br3N2/c11-8-9(12)15(10(13)14-8)6-7-4-2-1-3-5-7/h1-5H,6H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 60-62°C |
| Flash Point: | 241.6°C |
| Boiling Point: | 476°Cat760mmHg |
| Density: | 2.08g/cm3 |
| Refractive index: | 1.698 |
| Specification: |
1-benzyl-2,4,5-tribromo-imidazole , with CAS number of 31250-80-3, can be called 1-Benzyl-2,4,5-tribromo-1H-imidazole ; 1H-imidazole, 2,4,5-tribromo-1-(phenylmethyl)- ; 31250-80-3 [RN] . |
| Flash Point: | 241.6°C |
| Safety Data | |
 |
|
