| Identification |
| Name: | Phenol,4-[[4-(4-chlorophenyl)-2-thiazolyl]amino]- |
| Synonyms: | SKI 2 |
| CAS: | 312636-16-1 |
| Molecular Formula: | C15H11 Cl N2 O S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C15H11ClN2OS/c16-11-3-1-10(2-4-11)14-9-20-15(18-14)17-12-5-7-13(19)8-6-12/h1-9,19H,(H,17,18) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 260.5°C |
| Boiling Point: | 507.1°Cat760mmHg |
| Density: | 1.415g/cm3 |
| Refractive index: | 1.709 |
| Biological Activity: | Selective non-lipid inhibitor of sphingosine kinase (IC 50 = 0.5 μ M); does not act at ATP-binding site. Displays no inhibition of ERK2, PI 3-kinase, or PKC α at concentrations up to 60 μ M. Reduces levels of sphingosine-1-phosphate in MDA-MB-231 breast cancer cells. Induces apoptosis and inhibits proliferation in several other tumor cell lines in vitro (IC 50 = 0.9-4.6 μ M). |
| Flash Point: | 260.5°C |
| Storage Temperature: | 2-8°C |
| Color: | off-white |
| Safety Data |
| |
 |
