| Identification | |
| Name: | Methanone,(5-amino-1,3-dimethyl-1H-pyrazol-4-yl)(2-fluorophenyl)- |
| Synonyms: | Ketone,5-amino-1,3-dimethylpyrazol-4-yl o-fluorophenyl (8CI); PD 71627 |
| CAS: | 31272-21-6 |
| Molecular Formula: | C12H12 F N3 O |
| Molecular Weight: | 233.27 |
| InChI: | InChI=1/C12H12FN3O/c1-7-10(12(14)16(2)15-7)11(17)8-5-3-4-6-9(8)13/h3-6H,14H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 210°C |
| Boiling Point: | 423.7°Cat760mmHg |
| Density: | 1.29g/cm3 |
| Refractive index: | 1.607 |
| Specification: |
5-Amino-1,3-dimethyl-4-pyrazolyl o-fluorophenyl ketone ,with CAS number of 31272-21-6,can be called Ketone, 5-amino-1,3-dimethylpyrazol-4-yl o-fluorophenyl ; Methanone, (5-amino-1,3-dimethyl-1H-pyrazol-4-yl)(2-fluorophenyl)- . 5-Amino-1,3-dimethyl-4-pyrazolyl o-fluorophenyl ketone (CAS NO.31272-21-6) is a moderately toxic substance,with flammability, burning will produce toxic fumes of nitrogen oxides and fluoride,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Report: |
5-Amino-1,3-dimethyl-4-pyrazolyl o-fluorophenyl ketone (CAS NO.31272-21-6) was reported in CRNGDP Carcinogenesis (London). |
| Flash Point: | 210°C |
| Safety Data | |
 |
|
