| Identification |
| Name: | Cyclohexylammonium benzoate |
| Synonyms: | N-Cyclohexylammonium benzoate;Cyclohexylamine benzoate;Benzoic acid, compd. with cyclohexylamine (1:1);Benzoic acid, compd. with cyclohexanamine (1:1);Benzoic acid, compd. with cyclohexylamine (1:1) (8CI);benzoic acid; cyclohexanamine;Benzoic acid, compound with cyclohexylamine (1:1);cyclohexanamine benzoate (1:1);benzoic acid; cyclohexanamine; |
| CAS: | 3129-92-8 |
| EINECS: | 221-516-4 |
| Molecular Formula: | C13H19NO2 |
| Molecular Weight: | 215.25 |
| InChI: | InChI=1/C7H6O2.C6H13N/c8-7(9)6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h1-5H,(H,8,9);6H,1-5,7H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 111.4°C |
| Boiling Point: | 249.3°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 111.4°C |
| Safety Data |
| |
 |
