| Identification | |
| Name: | 1H-Indole-7-carboxylicacid, 3-formyl-, methyl ester |
| Synonyms: | 3-Formyl-1H-indole-7-carboxylicacid methyl ester |
| CAS: | 312973-24-3 |
| Molecular Formula: | C11H9NO3 |
| Molecular Weight: | 203.19 |
| InChI: | InChI=1/C11H9NO3/c1-15-11(14)9-4-2-3-8-7(6-13)5-12-10(8)9/h2-6,12H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.341 |
| Refractive index: | 1.677 |
| Specification: |
The 3-Formylindole-7-carboxylic acid methyl ester with the cas number 312973-24-3 is also called 1H-Indole-7-carboxylicacid, 3-formyl-, methyl ester. The systematic name is methyl 3-formyl-1H-indole-7-carboxylate. Its molecular formula is C11H9NO3. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.66; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4 #H bond donors: 1 ; (4)#Freely Rotating Bonds: 3; (5)Polar Surface Area: 48.3 Å2; (6)Index of Refraction: 1.677; (7)Molar Refractivity: 57.05 cm3; (8)Molar Volume: 151.4 cm3; (9)Polarizability: 22.61×10-24cm3; (10)Surface Tension: 59.5 dyne/cm; (11)Enthalpy of Vaporization: 65.59 kJ/mol; (12)Vapour Pressure: 9.46×10-7 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
