| Identification | |
| Name: | Estra-1,3,5(10)-trien-17-one,3,4-dihydroxy- |
| Synonyms: | 3,4-Dihydroxy-1,3,5(10)-estratrien-17-one;4-Hydroxyestrone |
| CAS: | 3131-23-5 |
| Molecular Formula: | C18H22 O3 |
| Molecular Weight: | 286.40 |
| InChI: | InChI=1/C18H22O3/c1-18-9-8-11-10-4-6-15(19)17(21)13(10)3-2-12(11)14(18)5-7-16(18)20/h4,6,11-12,14,19,21H,2-3,5,7-9H2,1H3/t11-,12-,14+,18+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 251.1°C |
| Boiling Point: | 468.2°Cat760mmHg |
| Density: | 1.241g/cm3 |
| Refractive index: | 1.61 |
| Flash Point: | 251.1°C |
| Storage Temperature: | −20°C |
| Usage: |
4-Hydroxyestrone ,whose cas register No. is 3131-23-5,can be used as a metabolite of estradiol. |
| Safety Data | |
| Hazard Symbols | |
 |
|
