| Identification |
| Name: | 3-Bromobenzaldehyde |
| Synonyms: | 3-Bromobenzaldehyde 98 % |
| CAS: | 3132-99-8 |
| EINECS: | 221-526-9 |
| Molecular Formula: | C7H5BrO |
| Molecular Weight: | 185.02 |
| InChI: | InChI=1/C7H5BrO/c8-7-3-1-2-6(4-7)5-9/h1-5H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2810 |
| Density: | 1.587 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.592-1.596 |
| Water Solubility: | DECOMPOSES |
| Solubility: | DECOMPOSES |
| Appearance: | Solid or clear yellow liquid. |
| Packinggroup: | III |
| HS Code: | 29130000 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Sensitive: | Air Sensitive |
| Color: | very faintly to deep brownish-yellow |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
