| Identification | |
| Name: | Bromacil |
| Synonyms: | Uracil,5-bromo-3-sec-butyl-6-methyl- (8CI);3-sec-Butyl-5-bromo-6-methyluracil;5-Bromo-3-sec-butyl-6-methyluracil;5-Bromo-6-methyl-3-(1-methyl-n-propyl)uracil;5-Bromo-6-methyl-3-(1-methylpropyl)uracil;5-Bromo-6-methyl-3-sec-butyluracil; |
| CAS: | 314-40-9 |
| EINECS: | 206-245-1 |
| Molecular Formula: | C9H13BrN2O2 |
| Molecular Weight: | 261.116 |
| InChI: | InChI=1S/C9H13BrN2O2/c1-4-5(2)12-8(13)7(10)6(3)11-9(12)14/h5H,4H2,1-3H3,(H,11,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Boiling Point: | 411 |
| Density: | 1.55 |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. |
| Refractive index: | 1.541 |
| Water Solubility: | Stability Stable. |
| Solubility: | Stability Stable. |
| Appearance: | white to beige crystalline solid |
| Report: |
EPA Genetic Toxicology Program. |
| Color: | White crystalline solid Colorless crystals |
| Usage: | Herbicide. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
