| Identification | |
| Name: | 2,3-dibromo-thiophene |
| Synonyms: | 2,3-dibromothiophene |
| CAS: | 3140-93-0 |
| EINECS: | 221-542-6 |
| Molecular Formula: | C4H2Br2S |
| Molecular Weight: | 241.93 |
| InChI: | InChI=1/C4H2Br2S/c5-3-1-2-7-4(3)6/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Melting Point: | -17.5 |
| Density: | 2.137 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.63-1.632 |
| Solubility: | Insoluble |
| Appearance: | colorless transparent liquid |
| Specification: |
2,3-Dibromothiophene , its CAS NO. is 3140-93-0, the synonyms are Adenosine, 2',3'-dideoxy- ; BRN 0619924 ; CCRIS 428 ; D2A ; Dideoxyadenosine ; EINECS 223-853-2 ; NSC 98700 ; ddA ; ddAdo . |
| Packinggroup: | III |
| HS Code: | 29349990 |
| Storage Temperature: | Flammables area |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
