| Identification | |
| Name: | Ethanone,1-(3,4-dimethoxyphenyl)-2-phenyl- |
| Synonyms: | Acetophenone,3',4'-dimethoxy-2-phenyl- (6CI,7CI,8CI);1-(3,4-Dimethoxyphenyl)-2-phenylethanone;Benzyl 3,4-dimethoxyphenyl ketone; |
| CAS: | 3141-93-3 |
| Molecular Formula: | C16H16O3 |
| Molecular Weight: | 256.3 |
| InChI: | InChI=1/C16H16O3/c1-18-15-9-8-13(11-16(15)19-2)14(17)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.115g/cm3 |
| Refractive index: | 1.558? |
| Specification: |
The 1-(3,4-Dimethoxyphenyl)-2-phenylethanone is a kind of organic compounds with cas registry number of 3141-93-3. It is also known as Benzyl 3,4-dimethoxyphenyl ketone. This chemical has a systematic name which is called 1-(3,4-dimethoxyphenyl)-2-phenylethanone. The physical properties about this chemical are: (1)ACD/LogP: 3.34; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 3; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 5; (6)Index of Refraction: 1.558; (7)Molar Refractivity: 74.12 cm3; (8)Molar Volume: 229.6 cm3; (9)Surface Tension: 40 dyne/cm; (10)Density: 1.115 g/cm3; (11)Flash Point: 186.1 °C; (12)Enthalpy of Vaporization: 64.85 kJ/mol; (13)Boiling Point: 398 °C at 760 mmHg; (14)Vapour Pressure: 1.53E-06 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
