| Identification | |
| Name: | Thiourea,N-(5-bromo-2-pyridinyl)- |
| Synonyms: | Thiourea,(5-bromo-2-pyridinyl)- (9CI); Urea, 1-(5-bromo-2-pyridyl)-2-thio- (8CI) |
| CAS: | 31430-38-3 |
| Molecular Formula: | C6H6 Br N3 S |
| Molecular Weight: | 232.10 |
| InChI: | InChI=1/C6H6BrN3S/c7-4-1-2-5(9-3-4)10-6(8)11/h1-3H,(H3,8,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 154.377°C |
| Boiling Point: | 331.651°C at 760 mmHg |
| Density: | 1.828 |
| Refractive index: | 1.764 |
| Specification: |
The 1-(5-Bromo-2-pyridyl)-2-thiourea with the cas number 31430-38-3, is also called thiourea, N-(5-bromo-2-pyridinyl)- .The properties of the 1-(5-Bromo-2-pyridyl)-2-thiourea are: (1)#H bond acceptors: 3 ; (2)#H bond donors: 3 ; (3)#Freely Rotating Bonds: 0 ; (4)Polar Surface Area: 83.03 Å2 ; (5)Index of Refraction: 1.764 ; (6)Molar Refractivity: 52.468 cm3 ; (7)Molar Volume: 126.964 cm3 ; (8)Polarizability: 20.8×10-24cm3 ; (9)Surface Tension: 85.777 dyne/cm ; (10)Enthalpy of Vaporization: 57.434 kJ/mol ; (11)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure : |
| Flash Point: | 154.377°C |
| Safety Data | |
 |
|
