| Identification | |
| Name: | b-D-Galactopyranoside,4-nitrophenyl |
| Synonyms: | Galactopyranoside,p-nitrophenyl, b-D-(6CI,7CI,8CI);4-Nitrophenyl galactoside;p-Nitrophenolgalactoside;p-Nitrophenyl b-D-galactopyranoside;p-Nitrophenyl b-D-galactoside;p-Nitrophenyl-b-galactopyranoside; |
| CAS: | 3150-24-1 |
| EINECS: | 221-584-5 |
| Molecular Formula: | C12H15NO8 |
| Molecular Weight: | 301.2494 |
| InChI: | InChI=1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.599 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | white to light yellow crystalline powder |
| Specification: |
b-D-Galactopyranoside,4-nitrophenyl , with CAS number of 3150-24-1, can be called 4-Nitrophenyl-b-d-galactoside ; 4-nitrophenyl-beta-d-galactoside ; 4-nitrophenyl beta-d-galactoside-(1,5) ; 4-nitrophenyl-beta-d-galaktopyranoside ; nitrophenyl-b-d-galactopyranoside, 4- ; p-nitrophenyl beta-d-galactopyranoside ; p-nitrophenyl beta-d-galactoside . It is a white to light yellow crystalline powder. |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
