| Identification | |
| Name: | 1,1'-Biphenyl,2,3',4,4',5-pentachloro- |
| Synonyms: | Biphenyl,2,3',4,4',5-pentachloro- (8CI); 2,3',4,4',5-Pentachloro-1,1'-biphenyl;2,3',4,4',5-Pentachlorobiphenyl; 2,4,5,3',4'-Pentachlorobiphenyl;3,4,2',4',5'-Pentachlorobiphenyl; CB 118; PCB 118 |
| CAS: | 31508-00-6 |
| EINECS: | 215-648-1 |
| Molecular Formula: | C12H5 Cl5 |
| Molecular Weight: | 326.42 |
| InChI: | InChI=1S/C12H5Cl5/c13-8-2-1-6(3-10(8)15)7-4-11(16)12(17)5-9(7)14/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3432 9/PG 2 |
| Flash Point: | 190.6°C |
| Boiling Point: | 388.2°Cat760mmHg |
| Density: | 1.522g/cm3 |
| Refractive index: | 1.619 |
| Specification: |
2,3',4,4',5-Pentachlorobiphenyl with CAS Registry Number of 31508-00-6 is also known as 3,4,2',4',5'-Pentachlorobiphenyl ; Biphenyl, 2,3',4,4',5-pentachloro- ; PCB 118 ; 1,1'-Biphenyl, 2,3',4,4',5-pentachloro- . |
| Flash Point: | 190.6°C |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
