Identification |
Name: | 1-Piperazineaceticacid, 4-(phenylmethyl)-,2-[[2-hydroxy-3-(2-propen-1-yl)phenyl]methylene]hydrazide |
Synonyms: | 1-Piperazineaceticacid, 4-(phenylmethyl)-, [[2-hydroxy-3-(2-propenyl)phenyl]methylene]hydrazide(9CI) |
CAS: | 315183-21-2 |
Molecular Formula: | C23H28 N4 O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C23H28N4O2/c1-2-7-20-10-6-11-21(23(20)29)16-24-25-22(28)18-27-14-12-26(13-15-27)17-19-8-4-3-5-9-19/h2-6,8-11,16,29H,1,7,12-15,17-18H2,(H,25,28)/b24-16+ |
Molecular Structure: |
![(C23H28N4O2) 1-Piperazineaceticacid, 4-(phenylmethyl)-, [[2-hydroxy-3-(2-propenyl)phenyl]methylene]hydrazide(9CI)](https://img1.guidechem.com/chem/e/dict/12/315183-21-2.jpg) |
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | g/cm3 |
Biological Activity: | Procaspase-activating compound; activates procaspase-3 to produce caspase-3 (EC 50 = 0.22 μ M). Also activates procaspase-7 in a less efficient manner (EC 50 = 4.5 μ M). Pro-apoptotic; induces apoptosis in both cancerous and non-cancerous cells dependent on procaspase-3 concentration (IC 50 values are 0.003-1.41 and 5.02-9.98 μ M respectively). |
Flash Point: | °C |
Safety Data |
|
 |