| Identification |
| Name: | Butanoic acid,4-chloro-, methyl ester |
| Synonyms: | Methyl 4-chlorobutyrate;Butyricacid, 4-chloro-, methyl ester (7CI,8CI);4-Chlorobutanoic acid methyl ester;4-Chlorobutyric acid methyl ester;Methyl 4-chlorobutanoate;Methyl4-chlorobutyrate;Methyl g-chlorobutyrate;Methyl w-chlorobutyrate;NSC 66271;g-Chlorobutyric acid methyl ester; |
| CAS: | 3153-37-5 |
| EINECS: | 221-592-9 |
| Molecular Formula: | C5H9ClO2 |
| Molecular Weight: | 136.58 |
| InChI: | InChI=1/C5H9ClO2/c1-8-5(7)3-2-4-6/h2-4H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3272 |
| Density: | 1.12 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4311-1.4331 |
| Solubility: | Slightly soluble |
| Packinggroup: | III |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
