Identification |
Name: | Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one,4',5'-dibromo-3',6'-dihydroxy-2',7'-diiodo- |
Synonyms: | Fluorescein,4',5'-dibromo-2',7'-diiodo- (7CI,8CI); 4,5-Dibromo-2,7-diiodo-3,6-fluorandiol;C.I. Solvent Orange 18; D And C Orange Number 16; D and C Orange No. 16;Dibromodiiodofluorescein |
CAS: | 31544-98-6 |
Molecular Formula: | C20H8 Br2 I2 O5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C20H8Br2I2O5/c21-13-15(25)11(23)5-9-17(13)28-18-10(6-12(24)16(26)14(18)22)20(9)8-4-2-1-3-7(8)19(27)29-20/h1-6,25-26H |
Molecular Structure: |
|
Properties |
Flash Point: | 333.7°C |
Boiling Point: | 628.1°C at 760 mmHg |
Density: | 2.73g/cm3 |
Refractive index: | 1.93 |
Flash Point: | 333.7°C |
Safety Data |
|
|