| Identification | |
| Name: | 1H-Pyrrole,1-methyl-2-(2-nitroethenyl)- |
| Synonyms: | Pyrrole,1-methyl-2-(2-nitrovinyl)- (7CI,8CI); NSC 106284 |
| CAS: | 3156-50-1 |
| Molecular Formula: | C7H8 N2 O2 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C7H8N2O2/c1-8-5-2-3-7(8)4-6-9(10)11/h2-6H,1H3/b6-4+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 122 oC |
| Boiling Point: | 278 oC |
| Density: | 1.15 |
| Refractive index: | 1.544 |
| Appearance: | yellow solid |
| Specification: |
1H-Pyrrole,1-methyl-2-(2-nitroethenyl)- , its cas register number is 3156-50-1. It also can be called 1-Methyl-2-(2-nitroethenyl)-pyrrole ; 1-Methyl-2-(2-nitrovinyl)-1H-pyrrole ; and NSC 106284 . |
| Flash Point: | 122 oC |
| Safety Data | |
 |
|
