| Identification | |
| Name: | 1-Penten-3-one,4-methyl-1-phenyl- |
| Synonyms: | 4-Methyl-1-phenyl-1-penten-3-one;4-Methyl-3-oxo-1-phenyl-1-pentene; Isopropyl styryl ketone; NSC 10750; NSC651783 |
| CAS: | 3160-32-5 |
| EINECS: | 221-606-3 |
| Molecular Formula: | C12H14 O |
| Molecular Weight: | 174.26 |
| InChI: | InChI=1/C12H14O/c1-10(2)12(13)9-8-11-6-4-3-5-7-11/h3-10H,1-2H3/b9-8+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 103.8°C |
| Boiling Point: | 286°Cat760mmHg |
| Density: | 0.982g/cm3 |
| Refractive index: | 1.544 |
| Specification: |
Isopropyl styryl ketone ,its cas register number is 3160-32-5.It also can be called 1-07-00-00198 (Beilstein Handbook Reference) , 4-Methyl-1-phenyl-1-penten-3-one , AI3-21917 , BRN 1861618 , EINECS 221-606-3 , NSC 10750 , NSC 651783 , 1-Penten-3-one, 4-methyl-1-phenyl- and 4-Methyl-1-phenylpent-1-en-3-one . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 103.8°C |
| Safety Data | |
 |
|
