| Identification | |
| Name: | 2-Propenoic acid,9-anthracenylmethyl ester |
| Synonyms: | Acrylicacid, 9-anthrylmethyl ester (7CI,8CI);9-Anthracenemethanol, acrylate (8CI);9-(Acryloyloxymethyl)anthracene;9-Anthracenylmethyl acrylate;9-Anthrylmethylacrylate;anthracen-9-ylmethyl prop-2-enoate; |
| CAS: | 31645-34-8 |
| Molecular Formula: | C18H14O2 |
| Molecular Weight: | 262.30 |
| InChI: | InChI=1/C18H14O2/c1-2-18(19)20-12-17-15-9-5-3-7-13(15)11-14-8-4-6-10-16(14)17/h2-11H,1,12H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.181 g/cm3 |
| Refractive index: | 1.662 |
| Specification: |
The 9-Anthracenylmethyl acrylate, with the CAS registry number 31645-34-8, has the systematic name of anthracen-9-ylmethyl prop-2-enoate. It belongs to the following product categories: C12 to C63; Photonic and Optical Materials; Carbonyl Compounds; Esters; Photoluminescent Materials; Fluorescent Monomers. And the molecular formula of the chemical is C18H14O2. The characteristics of 9-Anthracenylmethyl acrylate are as followings: (1)ACD/LogP: 4.73; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.73; (4)ACD/LogD (pH 7.4): 4.73; (5)ACD/BCF (pH 5.5): 2321.47; (6)ACD/BCF (pH 7.4): 2321.47; (7)ACD/KOC (pH 5.5): 8929.13; (8)ACD/KOC (pH 7.4): 8929.13; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 26.3 Å2; (13)Index of Refraction: 1.662; (14)Molar Refractivity: 82.25 cm3; (15)Molar Volume: 222 cm3; (16)Polarizability: 32.6×10-24cm3; (17)Surface Tension: 48.1 dyne/cm; (18)Density: 1.181 g/cm3; (19)Flash Point: 284.1 °C; (20)Enthalpy of Vaporization: 68.84 kJ/mol; (21)Boiling Point: 432.6 °C at 760 mmHg; (22)Vapour Pressure: 1.1E-07 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
