| Identification |
| Name: | Poly(oxy-1,2-ethanediyl),a-sulfo-w-(4-nonylphenoxy)-, ammonium salt(1:1) |
| Synonyms: | Glycols,polyethylene, mono(hydrogen sulfate), p-nonylphenyl ether, ammonium salt (8CI);Poly(oxy-1,2-ethanediyl), a-sulfo-w-(4-nonylphenoxy)-,ammonium salt (9CI); Phenol, p-nonyl-, monoether with polyethylene glycolmono(hydrogen sulfate) ammonium salt (8CI); AT 660; AT 670; Polyethylene glycolmono(p-nonylphenyl) ether ammonium sulfate; Polyethylene glycolmono(p-nonylphenyl) ether sulfate ammonium salt; Polyethylene glycolp-nonylphenyl ether sulfate ammonium salt; a-(p-Nonylphenyl)-w-hydroxypoly(oxyethylene) sulfate ammonium salt |
| CAS: | 31691-97-1 |
| Molecular Formula: | (C2H4 O)n C15 H24 O4 S . H3 N |
| Molecular Weight: | 264.403 |
| InChI: | InChI=1S/C17H28O2/c1-2-3-4-5-6-7-8-9-16-10-12-17(13-11-16)19-15-14-18/h10-13,18H,2-9,14-15H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 155.6°C |
| Boiling Point: | 385.2°Cat760mmHg |
| Density: | 0.958g/cm3 |
| Solubility: | Lower adducts (n<6): soluble in oil; higher adducts: soluble in water |
| Flash Point: | 155.6°C |
| Color: | Lower adducts (n20) pale yellow to off-white pastes or waxes |
| Safety Data |
| |
 |
