| Identification | |
| Name: | Benz[a]anthracene,6,8-dimethyl- |
| Synonyms: | 6,8-Dimethylbenz[a]anthracene;NSC 97737 |
| CAS: | 317-64-6 |
| Molecular Formula: | C20H16 |
| Molecular Weight: | 256.36 |
| InChI: | InChI=1/C20H16/c1-13-6-5-8-16-11-20-17-9-4-3-7-15(17)10-14(2)19(20)12-18(13)16/h3-12H,1-2H3 |
| Molecular Structure: | ![(C20H16) 6,8-Dimethylbenz[a]anthracene;NSC 97737](https://img1.guidechem.com/chem/e/dict/32/317-64-6.jpg) |
| Properties | |
| Flash Point: | 226.6°C |
| Boiling Point: | 462.3°C at 760 mmHg |
| Density: | 1.142g/cm3 |
| Refractive index: | 1.728 |
| Specification: |
6,8-Dimethylbenz(a)anthracene , its cas register number is 317-64-6. It also can be called 6,8-Dimethyl-1,2-benzanthracene ; BRN 2103048 ; NSC 97737 . When 6,8-Dimethylbenz(a)anthracene (CAS NO.317-64-6) is heated to decomposition, it emits acrid smoke and irritating fumes. |
| Flash Point: | 226.6°C |
| Safety Data | |
 |
|
