| Identification |
| Name: | Thiophene, 2,5-dichloro- |
| Synonyms: | 2,5-Dichlorothiophene;5-Chloro-2-thienyl chloride; NSC 60527 |
| CAS: | 3172-52-9 |
| EINECS: | 221-638-8 |
| Molecular Formula: | C4H2 Cl2 S |
| Molecular Weight: | 153.02 |
| InChI: | InChI=1S/C4H2Cl2S/c5-3-1-2-4(6)7-3/h1-2H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Flash Point: | 59 oC |
| Boiling Point: | 162 oC |
| Density: | 1.442 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.561-1.563 |
| Water Solubility: | slightly soluble IN WATER |
| Solubility: | slightly soluble IN WATER |
| Appearance: | Clear, Colorless to Light Yellow Liquid |
| Packinggroup: | II |
| Flash Point: | 59 oC |
| Safety Data |
| Hazard Symbols |
T+: Very toxic
|
| |
 |
