| Identification | |
| Name: | Benzene,1-methoxy-3-(2-nitroethenyl)- |
| Synonyms: | Anisole,m-(2-nitrovinyl)- (6CI,7CI,8CI);1-Methoxy-3-(2-nitrovinyl)benzene;2-(3-Methoxyphenyl)-1-nitroethene;3-Methoxy-b-nitrostyrene;NSC 93425;m-Methoxy-b-nitrostyrene;m-Methoxy-w-nitrostyrene; |
| CAS: | 3179-09-7 |
| Molecular Formula: | C9H9NO3 |
| Molecular Weight: | 179.17 |
| InChI: | InChI=1/C9H9NO3/c1-13-9-4-2-3-8(7-9)5-6-10(11)12/h2-7H,1H3/b6-5+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 91-95 ºC |
| Flash Point: | 145°C |
| Boiling Point: | 304.6°C at 760 mmHg |
| Density: | 1.189g/cm3 |
| Refractive index: | 1.58 |
| Specification: |
The 1-Methoxy-3-(2-nitrovinyl)benzene with cas registry number of 3179-09-7, it belongs to the following product categories: (1)Styrenes; (2)Phenyls & Phenyl-Het. Its IUPAC name is 1-methoxy-3-[(E)-2-nitroethenyl]benzene. Its storage temp.is just keeping cold. Preparation: this chemical can be prepared by 3-methoxy-benzaldehyde with nitromethane. The yield is about 79%. Uses of 1-Methoxy-3-(2-nitrovinyl)benzene: it can be used to produce 3-methoxy-phenethylamine. The reaction will need reagent LiAlH4 and solvent diethyl ether. When you are using this chemical, please be cautious about it as the following: Avoid contact with skin and eyes and do not breathe dust.
|
| Flash Point: | 145°C |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
