Identification |
Name: | Benzeneacetic acid,3-chloro-4-(2,5-dihydro-1H-pyrrol-1-yl)-a-methyl- |
CAS: | 31793-07-4 |
EINECS: | 250-805-8 |
Molecular Formula: | C13H14 Cl N O2 |
Molecular Weight: | 251.73 |
InChI: | InChI=1/C13H14ClNO2/c1-9(13(16)17)10-4-5-12(11(14)8-10)15-6-2-3-7-15/h2-5,8-9H,6-7H2,1H3,(H,16,17) |
Molecular Structure: |
|
Properties |
Flash Point: | 202.2°C |
Boiling Point: | 410.8°Cat760mmHg |
Density: | 1.298g/cm3 |
Refractive index: | 1.604 |
Specification: |
Pirprofen ,its cas register number is 31793-07-4. It also can be called Pirprofeno ; Pirprofenum ; Rengasil ; and 3-Chloro-4-(2,5-dihydro-1H-pyrrol-1-yl)-a-methylbenzeneacetic Acid .
|
Flash Point: | 202.2°C |
Safety Data |
|
|