Identification |
Name: | 9H-Fluoren-2-amine,N-hydroxy-N-phenyl- |
Synonyms: | Hydroxylamine,N-fluoren-2-yl-N-phenyl- (8CI); N-Fluoren-2-yl-N-phenylhydroxylamine;N-Phenyl-2-fluorenylhydroxylamine |
CAS: | 31874-15-4 |
Molecular Formula: | C19H15 N O |
Molecular Weight: | 273.35 |
InChI: | InChI=1/C19H15NO/c21-20(16-7-2-1-3-8-16)17-10-11-19-15(13-17)12-14-6-4-5-9-18(14)19/h1-11,13,21H,12H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 264.6°C |
Boiling Point: | 475.1°C at 760 mmHg |
Density: | 1.277g/cm3 |
Refractive index: | 1.723 |
Specification: |
N-Phenyl-2-fluorenylhydroxylamine , its cas register number is 31874-15-4. It also can be called Hydroxylamine, N-(2-fluorenyl)-N-phenyl- ; and N-Phenyl-N-9H-fluoren-2-ylhydroxylamine .
|
Flash Point: | 264.6°C |
Safety Data |
|
 |