| Identification | |
| Name: | 3(2H)-Furanone,dihydro-2-methyl- |
| Synonyms: | 2-Methyl-2H-furan-3-one;2-Methyl-3-ketotetrahydrofuran;2-Methyl-3-oxotetrahydrofuran;2-Methyl-tetrahydrofurfuryl-3-one;2-Methyloxolan-3-one;Dihydro-2-methyl-3(2H)-furanone;Dihydro-2-methyl-3-furanone; |
| CAS: | 3188-00-9 |
| EINECS: | 221-685-4 |
| Molecular Formula: | C5H8O2 |
| Molecular Weight: | 100.12 |
| InChI: | InChI=1/C5H8O2/c1-4-5(6)2-3-7-4/h4H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1224 3/PG 3 |
| Density: | 1.045 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.426-1.431 |
| Solubility: | Very soluble |
| Appearance: | Colorless to light yellow liquid |
| Specification: |
?2-Methyltetrahydrofuran-3-one (CAS NO.3188-00-9), its Synonyms are 2-Methyl-2H-furan-3-one ; 2-Methyl-3-ketotetrahydrofuran ; 2-Methyl-3-oxotetrahydrofuran ; 2-Methyl-4,5-dihydro-3(2H)-furanone ; 3(2H)-Furanone, dihydro-2-methyl- ; Dihydro-2-methyl-3(2H)-furanone ; Dihydro-2-methyl-3-furanone . |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
