| Identification | |
| Name: | 2-Bromo-2'-Methoxy Acetophenone |
| Synonyms: | alpha-Bromo-2-methoxyacetophenone; bromomethyl 2-methoxyphenyl ketone; 2-Bromo-2?Methoxy Acetophenone; 2-Bromo-2-Methoxyacetophenone; 2-Methoxyphenacyl bromide; alpha-Bromo-2'-methoxyacetophenone |
| CAS: | 31949-21-0 |
| EINECS: | 250-870-2 |
| Molecular Formula: | C9H9BrO2 |
| Molecular Weight: | 229.07 |
| InChI: | InChI=1/C9H9BrO2/c1-12-9-5-3-2-4-7(9)8(11)6-10/h2-5H,6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8 |
| Density: | 1301 |
| Refractive index: | 1.554 |
| Appearance: | - |
| Specification: |
2-Bromo-2'-methoxyacetophenone with cas registry number of 31949-21-0 is also known as 2-Bromo-1-(2-methoxyphenyl)ethanone ; Ethanone, 2-bromo-1-(2-methoxyphenyl)- ; O-Methoxy phenacylbromide ; 2'-Methoxyphenacyl bromide ; 2-Bromo-1-(2-methoxyphenyl)Ethan-1-One ; 2-Bromo-2'-methoxyacetophenone ; 2-Methoxyphenacyl bromide ; 2-Methoxyphenacyl bromide 98% ; Acetophenone, 2-bromo-2'-methoxy- ; Bromomethyl 2-methoxyphenyl ketone . It is a compound with the appearance of white to greyish-green crystalline powder . It should be stored in a cool,dry place and kept away from oxidizing agents . 2-Bromo-2'-methoxyacetophenone with cas registry number of 31949-21-0 is used as a pharmaceutical intermediate . |
| Packinggroup: | III |
| Storage Temperature: | Keep Cold |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
T: Toxic
C: Corrosive
|
 |
|
