| Identification | |
| Name: | 3-(carboxyoxy)-2-hydroxypropyl acetate |
| Synonyms: | Glycerol monoisostearate;Glyceryl monoisostearate;GLYCERYL ISOSTEARATE;Isooctadecanoic acid, monoester with glycerol;EINECS 266-124-4;Isostearic acid, 1,2,3-propaneriol ester (1:1);Isooctadecanoic acid, monoester with 1,2,3-propanetriol;AC1MHXKY;UNII-HYE7O27HAO;LS-169385;1,3-dihydroxypropan-2-yl 16-methylheptadecanoate;66085-00-5 |
| CAS: | 32057-14-0 |
| Molecular Formula: | C6H10O6 |
| Molecular Weight: | 178.14 |
| InChI: | InChI=1/C6H10O6/c1-4(7)11-2-5(8)3-12-6(9)10/h5,8H,2-3H2,1H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 149.4°C |
| Boiling Point: | 355.5°C at 760 mmHg |
| Density: | 1.371g/cm3 |
| Refractive index: | 1.472 |
| Flash Point: | 149.4°C |
| Safety Data | |
 |
|
