| Identification | |
| Name: | 1-fluoronaphthalene |
| Synonyms: | 1-FLUORO NAPHTHALENE; Fluoronaphthalene |
| CAS: | 321-38-0 |
| EINECS: | 206-287-0 |
| Molecular Formula: | C10H7F |
| Molecular Weight: | 146.16 |
| InChI: | InChI=1/C10H7F/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Density: | 1.332 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.592-1.594 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Irritant. Toxicity data (The meaning of any toxicological abbreviations which appear in |
| Solubility: |
|
| Appearance: | Needles. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
