| Identification | |
| Name: | Benzeneacetonitrile,2,3-dichloro- |
| Synonyms: | Acetonitrile,(2,3-dichlorophenyl)- (7CI,8CI);2,3-Dichlorobenzeneacetonitrile; |
| CAS: | 3218-45-9 |
| Molecular Formula: | C8H5Cl2N |
| Molecular Weight: | 186.04 |
| InChI: | InChI=1/C8H5Cl2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3439 |
| Density: | 1.333 g/cm3 |
| Refractive index: | 1.565 |
| Appearance: | Transparent colorless liquid |
| Specification: |
2,3-Dichlorophenylacetonitrile , its cas register number is 3218-45-9. It also can be called 2,3-Dichlorobenzyl cyanide ; and Benzeneacetonitrile, 2,3-dichloro- . |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
