| Identification | |
| Name: | 4-Quinolinol,7-(trifluoromethyl)- |
| Synonyms: | 4-Hydroxy-7-(trifluoromethyl)quinoline;7-Trifluoromethyl-4-hydroxyquinoline; 7-Trifluoromethyl-4-quinolinol; NSC 77093 |
| CAS: | 322-97-4 |
| EINECS: | 206-298-0 |
| Molecular Formula: | C10H6 F3 N O |
| Molecular Weight: | 213.16 |
| InChI: | InChI=1/C15H8F3NO/c16-11-4-3-9(14(17)15(11)18)8-1-2-10-12(7-8)19-6-5-13(10)20/h1-7H,(H,19,20) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 266-269 °C(lit.) |
| Flash Point: | 114.4°C |
| Boiling Point: | 265.6°Cat760mmHg |
| Density: | 1.369g/cm3 |
| Refractive index: | 1.629 |
| Appearance: | Light greyish-beige powder |
| Specification: |
7-(Trifluorophenyl)quinolin-4-ol , with CAS number of 322-97-4, can be called 4(1H)-quinolinone, 7-(trifluoromethyl)- ; 4-quinolinol, 7-(trifluoromethyl)- ; 4-Hydroxy-7-trifluoromethylquinoline . It is a light greyish-beige powder. |
| Flash Point: | 114.4°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
