| Identification | |
| Name: | Octane, 2-methyl- |
| Synonyms: | 2-Methyloctane;NSC 23695 |
| CAS: | 3221-61-2 |
| EINECS: | 221-748-6 |
| Molecular Formula: | C9H20 |
| Molecular Weight: | 128.26 |
| InChI: | InChI=1/C9H20/c1-4-5-6-7-8-9(2)3/h9H,4-8H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 3/PG 3 |
| Melting Point: | -80 C |
| Flash Point: | 25.2°C |
| Boiling Point: | 143.3°Cat760mmHg |
| Density: | 0.722g/cm3 |
| Stability: | Stable. Highly flammable. Incompatible with strong oxidizing agents. Vapour may form explosive mixtures with air. |
| Refractive index: | n20/D 1.403 |
| Appearance: | colourless liquid |
| Packinggroup: | III |
| Flash Point: | 25.2°C |
| Safety Data | |
 |
|
