Identification |
Name: | Cyclopenta[c]furo[3',2':4,5]furo[2,3-h][1]benzopyran-1,11-dione,2,3,6a,9a-tetrahydro-4-hydroxy-, (6aR,9aS)- |
Synonyms: | Cyclopenta[c]furo[3',2':4,5]furo[2,3-h][1]benzopyran-1,11-dione,2,3,6a,9a-tetrahydro-4-hydroxy-, (6aR-cis)-;Cyclopenta[c]furo[3',2':4,5]furo[2,3-h][1]benzopyran-1,11-dione, 2,3,6aa,9aa-tetrahydro-4-hydroxy- (8CI); AFP1; Aflatoxin P1 |
CAS: | 32215-02-4 |
Molecular Formula: | C16H10 O6 |
Molecular Weight: | 0 |
InChI: | InChI=1/C16H10O6/c17-8-2-1-6-11-9(18)5-10-13(7-3-4-20-16(7)21-10)14(11)22-15(19)12(6)8/h3-5,7,16,18H,1-2H2/t7-,16+/m0/s1 |
Molecular Structure: |
|
Properties |
Transport: | UN 2811 6.1/PG 1 |
Flash Point: | 211.9°C |
Boiling Point: | 544.5°Cat760mmHg |
Density: | 1.7g/cm3 |
Refractive index: | 1.75 |
Packinggroup: | I |
Flash Point: | 211.9°C |
Storage Temperature: | 2-8°C |
Usage: | The oxidative metabolite of Aflatoxin B1; shows the highest risck of hepatocellular carcinoma. |
Safety Data |
Hazard Symbols |
T+: Very toxic
|
|
|