| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 2-methyl- |
| Synonyms: | Nicotinicacid, 2-methyl- (6CI,7CI,8CI);2-Methyl-3-pyridinecarboxylic acid;2-Picoline-3-carboxylic acid;2-Methyl-nicotinic acid;2-Methylpyridine-3-carboxylic acid; |
| CAS: | 3222-56-8 |
| Molecular Formula: | C7H7NO2 |
| Molecular Weight: | 137.14 |
| InChI: | InChI=1/C8H9NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h1-2,5-6H,3-4H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.23 g/cm3 |
| Refractive index: | 1.546 |
| Appearance: | Off-white Plates |
| Specification: |
2-Methylnicotinic acid , its cas register number is 3222-56-8. It also can be called 2-Methylpyridine-3-carboxylic acid ; Nicotinicacid, 2-methyl- (6CI,7CI,8CI) ; 2-Methyl-nicotinic acid ; and 2-Picoline-3-carboxylic acid . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
