Specification: |
The 5-Bromo-2,4-dimethoxybenzoic acid, its cas register number is 32246-20-1. It also can be called as Benzoic acid,5-bromo-2,4-dimethoxy- and the Systematic name about this chemical is 5-bromo-2,4-dimethoxybenzoic acid. It belongs to the following product categories, such as C9, Carbonyl Compounds, Carboxylic Acids and so on.
Physical properties about 5-Bromo-2,4-dimethoxybenzoic acid are: (1)#H bond acceptors: 4; (2)#H bond donors: 1; (3)#Freely Rotating Bonds: 3; (4)Polar Surface Area: 55.76Å2; (5)Index of Refraction: 1.566; (6)Molar Refractivity: 54.23 cm3; (7)Molar Volume: 166.152 cm3; (8)Polarizability: 21.498x10-24cm3; (9)Surface Tension: 46.225 dyne/cm; (10)Enthalpy of Vaporization: 63.714 kJ/mol
You can still convert the following datas into molecular structure:
(1)SMILES: COc1cc(OC)c(cc1Br)C(O)=O
(2)InChI: InChI=1/C9H9BrO4/c1-13-7-4-8(14-2)6(10)3-5(7)9(11)12/h3-4H,1-2H3,(H,11,12)
(3)InChIKey: WOPJFSQYDOHZMK-UHFFFAOYAZ
(4)Std. InChI: InChI=1S/C9H9BrO4/c1-13-7-4-8(14-2)6(10)3-5(7)9(11)12/h3-4H,1-2H3,(H,11,12)
(5)Std. InChIKey: WOPJFSQYDOHZMK-UHFFFAOYSA-N
|