| Identification | |
| Name: | Carbamodithioic acid,N,N-dimethyl-, ammonium salt (1:1) |
| Synonyms: | Carbamicacid, dimethyldithio-, ammonium salt (8CI); Carbamodithioic acid, dimethyl-,ammonium salt (9CI); Ammonium dimethyldithiocarbamate; Dimethylamobam; Diram A |
| CAS: | 3226-36-6 |
| EINECS: | 221-757-5 |
| Molecular Formula: | C3H7 N S2 . H3 N |
| Molecular Weight: | 138.27 |
| InChI: | InChI=1/C3H7NS2.H3N/c1-4(2)3(5)6;/h1-2H3,(H,5,6);1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 32°C |
| Boiling Point: | 129.4°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Ammonium dimethyl dithiocarbamate (CAS NO.3226-36-6) is also named as Ammonium dimethylcarbodithioate ; Dimethylamobam ; Dimethyldithiocarbamic acid, ammonium salt ; Dimethyldithiokarbaman ammony ; Dimethyldithiokarbaman ammony [Czech] ; Diram A ; Carbamic acid, dimethyldithio-, ammonium salt ; Carbodithioic acid, dimethyl-, ammonium salt (9CI) . Ammonium dimethyl dithiocarbamate (CAS NO.3226-36-6) is moderate toxic. It will produce toxic sulfur oxides, nitrogen oxides and ammonia fumes by high temperature. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 32°C |
| Safety Data | |
 |
|
