| Identification |
| Name: | N-Salicylidene-N'-salicyloylhydrazine |
| Synonyms: | Salicylidene salicylhydrazide; 2-Hydroxybenzylidene 2-hydroxybenzhydrazide |
| CAS: | 3232-36-8 |
| EINECS: | 221-773-2 |
| Molecular Formula: | C14H12N2O3 |
| Molecular Weight: | 256.26 |
| InChI: | InChI=1/C14H12N2O3/c17-12-7-3-1-5-10(12)9-15-16-14(19)11-6-2-4-8-13(11)18/h1-9,17-18H,(H,16,19)/b15-9- |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 280-284°C |
| Flash Point: | 212.2°C |
| Boiling Point: | 427.3°Cat760mmHg |
| Density: | 1.406g/cm3 |
| Refractive index: | 1.615 |
| Biological Activity: | Potent and selective partial inhibitor of β 1-containing GABA A receptors (IC 50 values are 4.5, 5.3 and 7.9 nM at α 2 β 1 γ 1 θ , α 2 β 1 γ 1 and α 2 β 1 γ 2s GABA A receptors respectively). May bind allosterically to a novel site on GABA A receptor. |
| Flash Point: | 212.2°C |
| Color: | off-white |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
