| Identification | |
| Name: | 123425-40-1 |
| Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 1,1-dichloroethene and 2-methyl-2-propenenitrile;2-propenoic acid, 2-methyl-, methyl ester, polymerwith 1,1-dichloroethene and 2-methyl-2-propenenitrile;Vinylidene chloride, methacrylonitrile, methyl methacrylate copolymer |
| CAS: | 32335-23-2 |
| Molecular Formula: | C11H15Cl2NO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C5H8O2.C4H5N.C2H2Cl2/c1-4(2)5(6)7-3;1-4(2)3-5;1-2(3)4/h1H2,2-3H3;1H2,2H3;1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 10°C |
| Boiling Point: | 100.3°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 10°C |
| Safety Data | |
 |
|
