| Identification | |
| Name: | 2-Propenoic acid,2-methyl-, octadecyl ester |
| Synonyms: | Methacrylicacid, octadecyl ester (6CI,8CI);Acryester S;Acryester SMA;Blemmer SMA;LightEster S;NK Ester S;Octadecyl methacrylate;Rocryl 330;SR 324;SR 324(methacrylate);Stearyl methacrylate; |
| CAS: | 32360-05-7 |
| EINECS: | 251-013-5 |
| Molecular Formula: | C22H42 O2 |
| Molecular Weight: | 338.57 |
| InChI: | InChI=1S/C22H42O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3/h2,4-20H2,1,3H3 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Unstable (reactive) upon depletion of inhibitor. Hazardous polymerization may occur. |
| Refractive index: | n20/D 1.451(lit.) |
| Solubility: | Insoluble |
| Appearance: | Light yellow clear liquid |
| Specification: |
Octadecyl methacrylate , its cas register number is 32360-05-7. It also can be called 2-Propenoic acid, 2-methyl-, octadecyl ester ; Methacrylic acid, octadecyl ester ; Methacrylic acid, stearyl ester ; Octadecyl 2-methylprop-2-enoate ; Stearyl methacrylate ; 2-Propenoic acid,2-methyl-, octadecyl ester . |
| Storage Temperature: | Prevent moisture contact. Store in tightly closed, properly vented containers away from heat, sparks, open flame, strong oxidizers, radiation and other initiators. Prevent contamination by foreign materials. Use only non-sparking tools and limit storage time. |
| Safety Data | |
 |
|
